C18H23Cl4N3O3 — CID 60512864
tert-butyl N-[1-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]piperidin-4-yl]carbamate (PubChem CID 60512864) has the molecular formula C18H23Cl4N3O3 and a molecular weight of 471.21 g/mol. Its IUPAC name is tert-butyl N-[1-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 60512864 |
| Molecular Formula | C18H23Cl4N3O3 |
| Molecular Weight | 471.21 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | tert-butyl N-[1-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(=O)Nc2c(Cl)c(Cl)cc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C18H23Cl4N3O3/c1-18(2,3)28-17(27)23-10-4-6-25(7-5-10)9-13(26)24-16-14(21)11(19)8-12(20)15(16)22/h8,10H,4-7,9H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | ZKNBPHVIANCPPJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.21 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|