C14H16Cl4N2O2 — CID 60510321
2-[4-(hydroxymethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 60510321) has the molecular formula C14H16Cl4N2O2 and a molecular weight of 386.11 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-[4-(hydroxymethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 60510321 |
| Molecular Formula | C14H16Cl4N2O2 |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 2-[4-(hydroxymethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | O=C(CN1CCC(CO)CC1)Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H16Cl4N2O2/c15-9-5-10(16)13(18)14(12(9)17)19-11(22)6-20-3-1-8(7-21)2-4-20/h5,8,21H,1-4,6-7H2,(H,19,22) |
| InChIKey | XEOBSOMEAQWUAT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|