C16H19Cl4N3O2 — CID 86854756
2-[3-(acetamidomethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 86854756) has the molecular formula C16H19Cl4N3O2 and a molecular weight of 427.16 g/mol. Its IUPAC name is 2-[3-(acetamidomethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-[3-(acetamidomethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 86854756 |
| Molecular Formula | C16H19Cl4N3O2 |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-[3-(acetamidomethyl)piperidin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | CC(=O)NCC1CCCN(CC(=O)Nc2c(Cl)c(Cl)cc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C16H19Cl4N3O2/c1-9(24)21-6-10-3-2-4-23(7-10)8-13(25)22-16-14(19)11(17)5-12(18)15(16)20/h5,10H,2-4,6-8H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | JZWGWFMMCMMRDC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|