C12H24N2O — CID 95187387
N-[[(3S)-1-(2-methylpropyl)piperidin-3-yl]methyl]acetamide (PubChem CID 95187387) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N-[[(3S)-1-(2-methylpropyl)piperidin-3-yl]methyl]acetamide.
| Compound Name | N-[[(3S)-1-(2-methylpropyl)piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 95187387 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N-[[(3S)-1-(2-methylpropyl)piperidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1CCCN(CC(C)C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-10(2)8-14-6-4-5-12(9-14)7-13-11(3)15/h10,12H,4-9H2,1-3H3,(H,13,15)/t12-/m0/s1 |
| InChIKey | AKOFIUIWCSTBIF-LBPRGKRZSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |