C14H24N4OS — CID 56714920
4-methyl-N-[[1-(2-methylpropyl)piperidin-3-yl]methyl]thiadiazole-5-carboxamide (PubChem CID 56714920) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-methyl-N-[[1-(2-methylpropyl)piperidin-3-yl]methyl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[[1-(2-methylpropyl)piperidin-3-yl]methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 56714920 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-methyl-N-[[1-(2-methylpropyl)piperidin-3-yl]methyl]thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCC1CCCN(CC(C)C)C1 |
| InChI | InChI=1S/C14H24N4OS/c1-10(2)8-18-6-4-5-12(9-18)7-15-14(19)13-11(3)16-17-20-13/h10,12H,4-9H2,1-3H3,(H,15,19) |
| InChIKey | LHUHUMUCCUWVEO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |