C19H28FN3O3 — CID 55736834
tert-butyl N-[1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]piperidin-4-yl]carbamate (PubChem CID 55736834) has the molecular formula C19H28FN3O3 and a molecular weight of 365.45 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736834 |
| Molecular Formula | C19H28FN3O3 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | tert-butyl N-[1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H28FN3O3/c1-19(2,3)26-18(25)22-16-8-10-23(11-9-16)13-17(24)21-12-14-4-6-15(20)7-5-14/h4-7,16H,8-13H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | UELXKBCERYCVBS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |