C15H23ClFN3O — CID 119923412
N-[(4-fluorophenyl)methyl]-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 119923412) has the molecular formula C15H23ClFN3O and a molecular weight of 315.82 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119923412 |
| Molecular Formula | C15H23ClFN3O |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CNC1CCN(CC(=O)NCc2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C15H22FN3O.ClH/c1-17-14-6-8-19(9-7-14)11-15(20)18-10-12-2-4-13(16)5-3-12;/h2-5,14,17H,6-11H2,1H3,(H,18,20);1H |
| InChIKey | HCVJJFKYXGMLHZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |