C12H21F3N2O2 — CID 22562166
tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate (PubChem CID 22562166) has the molecular formula C12H21F3N2O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 22562166 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O2/c1-11(2,3)19-10(18)16-9-4-6-17(7-5-9)8-12(13,14)15/h9H,4-8H2,1-3H3,(H,16,18) |
| InChIKey | GZBNHUWODLVVSP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |