C20H30FN3O6 — CID 171637403
tert-butyl N-[1-[2-[2-(2-fluoro-4-nitrophenoxy)ethoxy]ethyl]piperidin-4-yl]carbamate (PubChem CID 171637403) has the molecular formula C20H30FN3O6 and a molecular weight of 427.47 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[2-(2-fluoro-4-nitrophenoxy)ethoxy]ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[2-(2-fluoro-4-nitrophenoxy)ethoxy]ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 171637403 |
| Molecular Formula | C20H30FN3O6 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | tert-butyl N-[1-[2-[2-(2-fluoro-4-nitrophenoxy)ethoxy]ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCOCCOc2ccc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C20H30FN3O6/c1-20(2,3)30-19(25)22-15-6-8-23(9-7-15)10-11-28-12-13-29-18-5-4-16(24(26)27)14-17(18)21/h4-5,14-15H,6-13H2,1-3H3,(H,22,25) |
| InChIKey | VKGCTTCNSWJCKT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|