C23H38N2O7S — CID 156865833
2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 156865833) has the molecular formula C23H38N2O7S and a molecular weight of 486.63 g/mol. Its IUPAC name is 2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 156865833 |
| Molecular Formula | C23H38N2O7S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-[2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCN2CCC(NC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H38N2O7S/c1-19-5-7-21(8-6-19)33(27,28)31-18-17-30-16-15-29-14-13-25-11-9-20(10-12-25)24-22(26)32-23(2,3)4/h5-8,20H,9-18H2,1-4H3,(H,24,26) |
| InChIKey | UGKUQVCGQYHWEP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|