C18H25BrN2O3 — CID 175940769
butyl N-[(1S,3R)-3-[(2-bromo-6-prop-1-enyl-3-pyridinyl)oxy]cyclopentyl]carbamate (PubChem CID 175940769) has the molecular formula C18H25BrN2O3 and a molecular weight of 397.31 g/mol. Its IUPAC name is butyl N-[(1S,3R)-3-[(2-bromo-6-prop-1-enyl-3-pyridinyl)oxy]cyclopentyl]carbamate.
| Compound Name | butyl N-[(1S,3R)-3-[(2-bromo-6-prop-1-enyl-3-pyridinyl)oxy]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 175940769 |
| Molecular Formula | C18H25BrN2O3 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | butyl N-[(1S,3R)-3-[(2-bromo-6-prop-1-enyl-3-pyridinyl)oxy]cyclopentyl]carbamate |
| SMILES | CC=Cc1ccc(O[C@@H]2CC[C@H](NC(=O)OCCCC)C2)c(Br)n1 |
| InChI | InChI=1S/C18H25BrN2O3/c1-3-5-11-23-18(22)21-14-7-9-15(12-14)24-16-10-8-13(6-4-2)20-17(16)19/h4,6,8,10,14-15H,3,5,7,9,11-12H2,1-2H3,(H,21,22)/t14-,15+/m0/s1 |
| InChIKey | JDSDJZSREJYAQZ-LSDHHAIUSA-N |
| XLogP | 4.70 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|