C15H23N3O3 — CID 90634770
ethyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]carbamate (PubChem CID 90634770) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is ethyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]carbamate.
| Compound Name | ethyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 90634770 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | ethyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]carbamate |
| SMILES | CCOC(=O)NC1CCC(Oc2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-4-20-15(19)18-12-5-7-13(8-6-12)21-14-16-10(2)9-11(3)17-14/h9,12-13H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | CXJDECYQICNELY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |