C16H23N3O2 — CID 90634657
(E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]but-2-enamide (PubChem CID 90634657) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]but-2-enamide.
| Compound Name | (E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]but-2-enamide |
|---|---|
| PubChem CID | 90634657 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NC1CCC(Oc2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C16H23N3O2/c1-4-5-15(20)19-13-6-8-14(9-7-13)21-16-17-11(2)10-12(3)18-16/h4-5,10,13-14H,6-9H2,1-3H3,(H,19,20)/b5-4+ |
| InChIKey | BMVHBRBHJQHTRW-SNAWJCMRSA-N |
| XLogP | 2.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|