C19H23FN4O2 — CID 90634951
1-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-3-(4-fluorophenyl)urea (PubChem CID 90634951) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 90634951 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-3-(4-fluorophenyl)urea |
| SMILES | Cc1cc(C)nc(OC2CCC(NC(=O)Nc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C19H23FN4O2/c1-12-11-13(2)22-19(21-12)26-17-9-7-16(8-10-17)24-18(25)23-15-5-3-14(20)4-6-15/h3-6,11,16-17H,7-10H2,1-2H3,(H2,23,24,25) |
| InChIKey | OCKYPAKSBKJMSP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |