C21H25FN2O2 — CID 11610101
1-(2,6-dimethylphenyl)-3-[4-(4-fluorophenoxy)cyclohexyl]urea (PubChem CID 11610101) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[4-(4-fluorophenoxy)cyclohexyl]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[4-(4-fluorophenoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 11610101 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[4-(4-fluorophenoxy)cyclohexyl]urea |
| SMILES | Cc1cccc(C)c1NC(=O)NC1CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H25FN2O2/c1-14-4-3-5-15(2)20(14)24-21(25)23-17-8-12-19(13-9-17)26-18-10-6-16(22)7-11-18/h3-7,10-11,17,19H,8-9,12-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | NAQVTFNHEFCUNX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |