C42H47FN4O6 — CID 162127990
1-[4-(4-acetylphenoxy)cyclohexyl]-3-(4-fluorophenyl)urea;1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea (PubChem CID 162127990) has the molecular formula C42H47FN4O6 and a molecular weight of 722.86 g/mol. Its IUPAC name is 1-[4-(4-acetylphenoxy)cyclohexyl]-3-(4-fluorophenyl)urea;1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea.
| Compound Name | 1-[4-(4-acetylphenoxy)cyclohexyl]-3-(4-fluorophenyl)urea;1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea |
|---|---|
| PubChem CID | 162127990 |
| Molecular Formula | C42H47FN4O6 |
| Molecular Weight | 722.86 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 1-[4-(4-acetylphenoxy)cyclohexyl]-3-(4-fluorophenyl)urea;1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea |
| SMILES | CC(=O)c1ccc(OC2CCC(NC(=O)Nc3ccc(F)cc3)CC2)cc1.CC(=O)c1ccc(OC2CCC(NC(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H23FN2O3.C21H24N2O3/c1-14(25)15-2-10-19(11-3-15)27-20-12-8-18(9-13-20)24-21(26)23-17-6-4-16(22)5-7-17;1-15(24)16-7-11-19(12-8-16)26-20-13-9-18(10-14-20)23-21(25)22-17-5-3-2-4-6-17/h2-7,10-11,18,20H,8-9,12-13H2,1H3,(H2,23,24,26);2-8,11-12,18,20H,9-10,13-14H2,1H3,(H2,22,23,25) |
| InChIKey | ZIHGTDJPXJAZPJ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.86 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |