C21H24N2O3 — CID 158421344
1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea (PubChem CID 158421344) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea.
| Compound Name | 1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea |
|---|---|
| PubChem CID | 158421344 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[4-(4-acetylphenoxy)cyclohexyl]-3-phenylurea |
| SMILES | CC(=O)c1ccc(OC2CCC(NC(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-15(24)16-7-11-19(12-8-16)26-20-13-9-18(10-14-20)23-21(25)22-17-5-3-2-4-6-17/h2-8,11-12,18,20H,9-10,13-14H2,1H3,(H2,22,23,25) |
| InChIKey | MADUTHKCVLAMIA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |