C19H20FIN2O2 — CID 59168731
1-[4-(4-fluorophenoxy)cyclohexyl]-3-(3-iodophenyl)urea (PubChem CID 59168731) has the molecular formula C19H20FIN2O2 and a molecular weight of 454.28 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)cyclohexyl]-3-(3-iodophenyl)urea.
| Compound Name | 1-[4-(4-fluorophenoxy)cyclohexyl]-3-(3-iodophenyl)urea |
|---|---|
| PubChem CID | 59168731 |
| Molecular Formula | C19H20FIN2O2 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)cyclohexyl]-3-(3-iodophenyl)urea |
| SMILES | O=C(Nc1cccc(I)c1)NC1CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20FIN2O2/c20-13-4-8-17(9-5-13)25-18-10-6-15(7-11-18)22-19(24)23-16-3-1-2-14(21)12-16/h1-5,8-9,12,15,18H,6-7,10-11H2,(H2,22,23,24) |
| InChIKey | QYSGZBAEAZOGLD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|