C20H21F2IN2O2 — CID 59168750
1-[4-[(2,6-difluorophenyl)methoxy]cyclohexyl]-3-(3-iodophenyl)urea (PubChem CID 59168750) has the molecular formula C20H21F2IN2O2 and a molecular weight of 486.30 g/mol. Its IUPAC name is 1-[4-[(2,6-difluorophenyl)methoxy]cyclohexyl]-3-(3-iodophenyl)urea.
| Compound Name | 1-[4-[(2,6-difluorophenyl)methoxy]cyclohexyl]-3-(3-iodophenyl)urea |
|---|---|
| PubChem CID | 59168750 |
| Molecular Formula | C20H21F2IN2O2 |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 1-[4-[(2,6-difluorophenyl)methoxy]cyclohexyl]-3-(3-iodophenyl)urea |
| SMILES | O=C(Nc1cccc(I)c1)NC1CCC(OCc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C20H21F2IN2O2/c21-18-5-2-6-19(22)17(18)12-27-16-9-7-14(8-10-16)24-20(26)25-15-4-1-3-13(23)11-15/h1-6,11,14,16H,7-10,12H2,(H2,24,25,26) |
| InChIKey | YBFIAOPDIWLAIR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|