C28H30N2O4 — CID 157304706
benzyl 4-[4-[(4-methylphenyl)carbamoylamino]cyclohexyl]oxybenzoate (PubChem CID 157304706) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is benzyl 4-[4-[(4-methylphenyl)carbamoylamino]cyclohexyl]oxybenzoate.
| Compound Name | benzyl 4-[4-[(4-methylphenyl)carbamoylamino]cyclohexyl]oxybenzoate |
|---|---|
| PubChem CID | 157304706 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | benzyl 4-[4-[(4-methylphenyl)carbamoylamino]cyclohexyl]oxybenzoate |
| SMILES | Cc1ccc(NC(=O)NC2CCC(Oc3ccc(C(=O)OCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H30N2O4/c1-20-7-11-23(12-8-20)29-28(32)30-24-13-17-26(18-14-24)34-25-15-9-22(10-16-25)27(31)33-19-21-5-3-2-4-6-21/h2-12,15-16,24,26H,13-14,17-19H2,1H3,(H2,29,30,32) |
| InChIKey | BCHXWIAXLVIYRR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |