C19H21N3O3 — CID 112989391
ethyl 4-[4-(cyclopropylcarbamoylamino)anilino]benzoate (PubChem CID 112989391) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl 4-[4-(cyclopropylcarbamoylamino)anilino]benzoate.
| Compound Name | ethyl 4-[4-(cyclopropylcarbamoylamino)anilino]benzoate |
|---|---|
| PubChem CID | 112989391 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 4-[4-(cyclopropylcarbamoylamino)anilino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccc(NC(=O)NC3CC3)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-2-25-18(23)13-3-5-14(6-4-13)20-15-7-9-16(10-8-15)21-19(24)22-17-11-12-17/h3-10,17,20H,2,11-12H2,1H3,(H2,21,22,24) |
| InChIKey | XJVUEZWHYPHMNJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |