C22H24F3N3O4 — CID 59053948
1-[4-(4-acetylphenoxy)cyclohexyl]-3-[4-(trifluoromethoxy)anilino]urea (PubChem CID 59053948) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is 1-[4-(4-acetylphenoxy)cyclohexyl]-3-[4-(trifluoromethoxy)anilino]urea.
| Compound Name | 1-[4-(4-acetylphenoxy)cyclohexyl]-3-[4-(trifluoromethoxy)anilino]urea |
|---|---|
| PubChem CID | 59053948 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-[4-(4-acetylphenoxy)cyclohexyl]-3-[4-(trifluoromethoxy)anilino]urea |
| SMILES | CC(=O)c1ccc(OC2CCC(NC(=O)NNc3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H24F3N3O4/c1-14(29)15-2-8-18(9-3-15)31-19-10-4-16(5-11-19)26-21(30)28-27-17-6-12-20(13-7-17)32-22(23,24)25/h2-3,6-9,12-13,16,19,27H,4-5,10-11H2,1H3,(H2,26,28,30) |
| InChIKey | PASRTZWJHZDWOT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|