C17H24F3N3O4S — CID 24811032
N-[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 24811032) has the molecular formula C17H24F3N3O4S and a molecular weight of 423.46 g/mol. Its IUPAC name is N-[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 24811032 |
| Molecular Formula | C17H24F3N3O4S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(C(=O)NNc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H24F3N3O4S/c1-11(2)28(25,26)23-14-5-3-12(4-6-14)16(24)22-21-13-7-9-15(10-8-13)27-17(18,19)20/h7-12,14,21,23H,3-6H2,1-2H3,(H,22,24) |
| InChIKey | AYHBTTSIJFCJQF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|