C19H19F3N4O3 — CID 30886215
N-[4-[[[4-(trifluoromethoxy)anilino]carbamoylamino]methyl]phenyl]cyclopropanecarboxamide (PubChem CID 30886215) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is N-[4-[[[4-(trifluoromethoxy)anilino]carbamoylamino]methyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[[4-(trifluoromethoxy)anilino]carbamoylamino]methyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 30886215 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[4-[[[4-(trifluoromethoxy)anilino]carbamoylamino]methyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(NCc1ccc(NC(=O)C2CC2)cc1)NNc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N4O3/c20-19(21,22)29-16-9-7-15(8-10-16)25-26-18(28)23-11-12-1-5-14(6-2-12)24-17(27)13-3-4-13/h1-2,5-10,13,25H,3-4,11H2,(H,24,27)(H2,23,26,28) |
| InChIKey | LACCNXDEWIRCAR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|