C16H15F4N3O2 — CID 30886356
1-[(3-fluoro-4-methylphenyl)methyl]-3-[4-(trifluoromethoxy)anilino]urea (PubChem CID 30886356) has the molecular formula C16H15F4N3O2 and a molecular weight of 357.31 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-3-[4-(trifluoromethoxy)anilino]urea.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-[4-(trifluoromethoxy)anilino]urea |
|---|---|
| PubChem CID | 30886356 |
| Molecular Formula | C16H15F4N3O2 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-[4-(trifluoromethoxy)anilino]urea |
| SMILES | Cc1ccc(CNC(=O)NNc2ccc(OC(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C16H15F4N3O2/c1-10-2-3-11(8-14(10)17)9-21-15(24)23-22-12-4-6-13(7-5-12)25-16(18,19)20/h2-8,22H,9H2,1H3,(H2,21,23,24) |
| InChIKey | RAEDAEZDUOMCSV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|