C14H16F3N5O2 — CID 71894162
1-(3-imidazol-1-ylpropyl)-3-[4-(trifluoromethoxy)anilino]urea (PubChem CID 71894162) has the molecular formula C14H16F3N5O2 and a molecular weight of 343.31 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-[4-(trifluoromethoxy)anilino]urea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-[4-(trifluoromethoxy)anilino]urea |
|---|---|
| PubChem CID | 71894162 |
| Molecular Formula | C14H16F3N5O2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-[4-(trifluoromethoxy)anilino]urea |
| SMILES | O=C(NCCCn1ccnc1)NNc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N5O2/c15-14(16,17)24-12-4-2-11(3-5-12)20-21-13(23)19-6-1-8-22-9-7-18-10-22/h2-5,7,9-10,20H,1,6,8H2,(H2,19,21,23) |
| InChIKey | CKDIAQVQTBGPIA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|