C17H23N3O3 — CID 6464359
2,4-diethoxy-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 6464359) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2,4-diethoxy-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 2,4-diethoxy-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 6464359 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2,4-diethoxy-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | CCOc1ccc(C(=O)NCCCn2ccnc2)c(OCC)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-3-22-14-6-7-15(16(12-14)23-4-2)17(21)19-8-5-10-20-11-9-18-13-20/h6-7,9,11-13H,3-5,8,10H2,1-2H3,(H,19,21) |
| InChIKey | NGMBIVNBGIABKP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|