C17H24N4O2 — CID 94759078
3-(3-amino-4-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)propanamide (PubChem CID 94759078) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 3-(3-amino-4-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)propanamide.
| Compound Name | 3-(3-amino-4-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 94759078 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-(3-amino-4-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)NCCCn2ccnc2)cc1N |
| InChI | InChI=1S/C17H24N4O2/c1-2-23-16-6-4-14(12-15(16)18)5-7-17(22)20-8-3-10-21-11-9-19-13-21/h4,6,9,11-13H,2-3,5,7-8,10,18H2,1H3,(H,20,22) |
| InChIKey | CHYGJMSCWQHIQC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|