C17H26N4O — CID 82257655
5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-propoxyaniline (PubChem CID 82257655) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-propoxyaniline.
| Compound Name | 5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-propoxyaniline |
|---|---|
| PubChem CID | 82257655 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-propoxyaniline |
| SMILES | CCCOc1ccc(CCNCCCn2ccnc2)cc1N |
| InChI | InChI=1S/C17H26N4O/c1-2-12-22-17-5-4-15(13-16(17)18)6-8-19-7-3-10-21-11-9-20-14-21/h4-5,9,11,13-14,19H,2-3,6-8,10,12,18H2,1H3 |
| InChIKey | UAUXWNPFQFCMDE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|