C17H13F4NO4 — CID 7796392
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate (PubChem CID 7796392) has the molecular formula C17H13F4NO4 and a molecular weight of 371.29 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7796392 |
| Molecular Formula | C17H13F4NO4 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(OC(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C17H13F4NO4/c1-10-2-5-12(8-14(10)18)22-15(23)9-25-16(24)11-3-6-13(7-4-11)26-17(19,20)21/h2-8H,9H2,1H3,(H,22,23) |
| InChIKey | MDGRFPTYUDFRTG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |