C19H19F3N2O5 — CID 67488219
4-[4-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]phenoxy]butanoic acid (PubChem CID 67488219) has the molecular formula C19H19F3N2O5 and a molecular weight of 412.36 g/mol. Its IUPAC name is 4-[4-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67488219 |
| Molecular Formula | C19H19F3N2O5 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[4-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(CNC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H19F3N2O5/c20-19(21,22)29-16-9-5-14(6-10-16)24-18(27)23-12-13-3-7-15(8-4-13)28-11-1-2-17(25)26/h3-10H,1-2,11-12H2,(H,25,26)(H2,23,24,27) |
| InChIKey | XEYPKQVNTOBEES-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|