C29H30F3N3O6 — CID 22502058
3-[[4-[(4-butoxyphenyl)-[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid (PubChem CID 22502058) has the molecular formula C29H30F3N3O6 and a molecular weight of 573.57 g/mol. Its IUPAC name is 3-[[4-[(4-butoxyphenyl)-[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(4-butoxyphenyl)-[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22502058 |
| Molecular Formula | C29H30F3N3O6 |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 3-[[4-[(4-butoxyphenyl)-[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCOc1ccc(C(NC(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccc(C(=O)NCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H30F3N3O6/c1-2-3-18-40-23-12-8-20(9-13-23)26(19-4-6-21(7-5-19)27(38)33-17-16-25(36)37)35-28(39)34-22-10-14-24(15-11-22)41-29(30,31)32/h4-15,26H,2-3,16-18H2,1H3,(H,33,38)(H,36,37)(H2,34,35,39) |
| InChIKey | BBTLVHGURWDVRY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|