C30H33F3N2O4 — CID 146224297
3-[[4-[[(2S)-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid (PubChem CID 146224297) has the molecular formula C30H33F3N2O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is 3-[[4-[[(2S)-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[(2S)-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146224297 |
| Molecular Formula | C30H33F3N2O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 3-[[4-[[(2S)-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCC[C@@H](Cc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1)Nc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H33F3N2O4/c1-2-3-4-5-26(35-25-14-10-24(11-15-25)29(38)34-19-18-28(36)37)20-21-6-8-22(9-7-21)23-12-16-27(17-13-23)39-30(31,32)33/h6-17,26,35H,2-5,18-20H2,1H3,(H,34,38)(H,36,37)/t26-/m0/s1 |
| InChIKey | CRCIIBMQYQSTPQ-SANMLTNESA-N |
| XLogP | 7.06 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|