C32H26F6N2O5 — CID 162581771
3-[[4-[1-[5-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethylamino)phenyl]phenyl]ethoxy]benzoyl]amino]propanoic acid (PubChem CID 162581771) has the molecular formula C32H26F6N2O5 and a molecular weight of 632.56 g/mol. Its IUPAC name is 3-[[4-[1-[5-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethylamino)phenyl]phenyl]ethoxy]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[5-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethylamino)phenyl]phenyl]ethoxy]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 162581771 |
| Molecular Formula | C32H26F6N2O5 |
| Molecular Weight | 632.56 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | 3-[[4-[1-[5-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethylamino)phenyl]phenyl]ethoxy]benzoyl]amino]propanoic acid |
| SMILES | CC(Oc1ccc(C(=O)NCCC(=O)O)cc1)c1cc(-c2ccc(OC(F)(F)F)cc2)ccc1-c1ccc(NC(F)(F)F)cc1 |
| InChI | InChI=1S/C32H26F6N2O5/c1-19(44-25-11-6-22(7-12-25)30(43)39-17-16-29(41)42)28-18-23(20-4-13-26(14-5-20)45-32(36,37)38)8-15-27(28)21-2-9-24(10-3-21)40-31(33,34)35/h2-15,18-19,40H,16-17H2,1H3,(H,39,43)(H,41,42) |
| InChIKey | RDXPTXGAXZTEIR-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.56 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|