C22H23F3N2O6 — CID 42963640
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[(4-butoxybenzoyl)amino]acetate (PubChem CID 42963640) has the molecular formula C22H23F3N2O6 and a molecular weight of 468.43 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[(4-butoxybenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[(4-butoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42963640 |
| Molecular Formula | C22H23F3N2O6 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[(4-butoxybenzoyl)amino]acetate |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)OCC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H23F3N2O6/c1-2-3-12-31-17-8-4-15(5-9-17)21(30)26-13-20(29)32-14-19(28)27-16-6-10-18(11-7-16)33-22(23,24)25/h4-11H,2-3,12-14H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | GETYBLUHSCKKDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|