C16H12F6N2O2 — CID 5000103
1-[4-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 5000103) has the molecular formula C16H12F6N2O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 5000103 |
| Molecular Formula | C16H12F6N2O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1C(F)(F)F)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F6N2O2/c17-15(18,19)13-4-2-1-3-10(13)9-23-14(25)24-11-5-7-12(8-6-11)26-16(20,21)22/h1-8H,9H2,(H2,23,24,25) |
| InChIKey | NAMNLMWZPXHORT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |