C11H10ClF3N2O2 — CID 62880642
2-chloro-N-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]acetamide (PubChem CID 62880642) has the molecular formula C11H10ClF3N2O2 and a molecular weight of 294.66 g/mol. Its IUPAC name is 2-chloro-N-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]acetamide.
| Compound Name | 2-chloro-N-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]acetamide |
|---|---|
| PubChem CID | 62880642 |
| Molecular Formula | C11H10ClF3N2O2 |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-chloro-N-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]acetamide |
| SMILES | O=C(CCl)NC(=O)NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H10ClF3N2O2/c12-5-9(18)17-10(19)16-6-7-3-1-2-4-8(7)11(13,14)15/h1-4H,5-6H2,(H2,16,17,18,19) |
| InChIKey | QYQVSAIZDDKZMX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|