C15H21F3N2O — CID 167116783
6-(methylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide (PubChem CID 167116783) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 6-(methylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide.
| Compound Name | 6-(methylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 167116783 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 6-(methylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide |
| SMILES | CNCCCCCC(=O)NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O/c1-19-10-6-2-3-9-14(21)20-11-12-7-4-5-8-13(12)15(16,17)18/h4-5,7-8,19H,2-3,6,9-11H2,1H3,(H,20,21) |
| InChIKey | XYJBGKHPCCJFOF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|