C15H19F3N2O — CID 164530484
6-(methylideneamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide (PubChem CID 164530484) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 6-(methylideneamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide.
| Compound Name | 6-(methylideneamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 164530484 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 6-(methylideneamino)-N-[[2-(trifluoromethyl)phenyl]methyl]hexanamide |
| SMILES | C=NCCCCCC(=O)NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O/c1-19-10-6-2-3-9-14(21)20-11-12-7-4-5-8-13(12)15(16,17)18/h4-5,7-8H,1-3,6,9-11H2,(H,20,21) |
| InChIKey | IZIPBUWHTSAOJQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|