C12H17ClF3N3O — CID 154905922
1-(3-aminopropyl)-3-[[2-(trifluoromethyl)phenyl]methyl]urea;hydrochloride (PubChem CID 154905922) has the molecular formula C12H17ClF3N3O and a molecular weight of 311.74 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-[[2-(trifluoromethyl)phenyl]methyl]urea;hydrochloride.
| Compound Name | 1-(3-aminopropyl)-3-[[2-(trifluoromethyl)phenyl]methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 154905922 |
| Molecular Formula | C12H17ClF3N3O |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(3-aminopropyl)-3-[[2-(trifluoromethyl)phenyl]methyl]urea;hydrochloride |
| SMILES | Cl.NCCCNC(=O)NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O.ClH/c13-12(14,15)10-5-2-1-4-9(10)8-18-11(19)17-7-3-6-16;/h1-2,4-5H,3,6-8,16H2,(H2,17,18,19);1H |
| InChIKey | KJJGJDDJMOECPM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|