C11H11ClF4N2O — CID 25119147
1-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(2-fluoroethyl)urea (PubChem CID 25119147) has the molecular formula C11H11ClF4N2O and a molecular weight of 298.67 g/mol. Its IUPAC name is 1-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(2-fluoroethyl)urea.
| Compound Name | 1-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(2-fluoroethyl)urea |
|---|---|
| PubChem CID | 25119147 |
| Molecular Formula | C11H11ClF4N2O |
| Molecular Weight | 298.67 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(2-fluoroethyl)urea |
| SMILES | O=C(NCCF)NCc1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C11H11ClF4N2O/c12-9-7(6-18-10(19)17-5-4-13)2-1-3-8(9)11(14,15)16/h1-3H,4-6H2,(H2,17,18,19) |
| InChIKey | YJIOKYUTXAKPSR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |