C12H14F3NO3 — CID 43473381
4-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid (PubChem CID 43473381) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 4-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 43473381 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO3/c13-12(14,15)19-10-5-3-9(4-6-10)8-16-7-1-2-11(17)18/h3-6,16H,1-2,7-8H2,(H,17,18) |
| InChIKey | FVSUGABRWWTUFK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|