C13H17F3N2O2 — CID 60926600
N,N-dimethyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide (PubChem CID 60926600) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is N,N-dimethyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide.
| Compound Name | N,N-dimethyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 60926600 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N,N-dimethyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide |
| SMILES | CN(C)C(=O)CCNCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-18(2)12(19)7-8-17-9-10-3-5-11(6-4-10)20-13(14,15)16/h3-6,17H,7-9H2,1-2H3 |
| InChIKey | RQZXBSFXOFLFRD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|