C25H36N4O2 — CID 67271625
tert-butyl 4-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 67271625) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is tert-butyl 4-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67271625 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | tert-butyl 4-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | Cc1cccnc1CN(Cc1ncccc1C)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-19-8-6-12-26-22(19)17-28(18-23-20(2)9-7-13-27-23)16-21-10-14-29(15-11-21)24(30)31-25(3,4)5/h6-9,12-13,21H,10-11,14-18H2,1-5H3 |
| InChIKey | IDJGJOQQGWRYLF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |