C23H32N4O2 — CID 67272262
tert-butyl 3-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]azetidine-1-carboxylate (PubChem CID 67272262) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is tert-butyl 3-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67272262 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | tert-butyl 3-[[bis[(3-methyl-2-pyridinyl)methyl]amino]methyl]azetidine-1-carboxylate |
| SMILES | Cc1cccnc1CN(Cc1ncccc1C)CC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H32N4O2/c1-17-8-6-10-24-20(17)15-26(16-21-18(2)9-7-11-25-21)12-19-13-27(14-19)22(28)29-23(3,4)5/h6-11,19H,12-16H2,1-5H3 |
| InChIKey | HOXNMZHUUYMDFN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |