tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate

C17H34N2O2 — CID 123464711

IUPACtert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate
SMILESCCCN(CCC)CC1CCN(C(=O)OC(C)(C)C)CC1
InChIInChI=1S/C17H34N2O2/c1-6-10-18(11-7-2)14-15-8-12-19(13-9-15)16(20)21-17(3,4)5/h15H,6-14H2,1-5H3
InChIKeyUGIKWVLLXBMOPU-UHFFFAOYSA-N
MW298.47 g/mol
LogP3.76
Rot. Bonds6

About tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate

tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate (PubChem CID 123464711) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate.

Molecular Properties

Compound Nametert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate
PubChem CID123464711
Molecular FormulaC17H34N2O2
Molecular Weight298.47 g/mol
Exact Mass298.26
IUPAC Nametert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate
SMILESCCCN(CCC)CC1CCN(C(=O)OC(C)(C)C)CC1
InChIInChI=1S/C17H34N2O2/c1-6-10-18(11-7-2)14-15-8-12-19(13-9-15)16(20)21-17(3,4)5/h15H,6-14H2,1-5H3
InChIKeyUGIKWVLLXBMOPU-UHFFFAOYSA-N
XLogP3.76
TPSA32.78 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.47
LogP ≤ 53.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate (CID 123464711) is tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate is CCCN(CCC)CC1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate?
The InChIKey is UGIKWVLLXBMOPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O2/c1-6-10-18(11-7-2)14-15-8-12-19(13-9-15)16(20)21-17(3,4)5/h15H,6-14H2,1-5H3.
What are the key properties of tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate?
tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate has a molecular weight of 298.47 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(dipropylamino)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 123464711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).