C28H56N2O2 — CID 129286225
tert-butyl 3-[[di(nonyl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 129286225) has the molecular formula C28H56N2O2 and a molecular weight of 452.77 g/mol. Its IUPAC name is tert-butyl 3-[[di(nonyl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[di(nonyl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 129286225 |
| Molecular Formula | C28H56N2O2 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.43 |
| IUPAC Name | tert-butyl 3-[[di(nonyl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCCN(CCCCCCCCC)CC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H56N2O2/c1-6-8-10-12-14-16-18-21-29(22-19-17-15-13-11-9-7-2)24-26-20-23-30(25-26)27(31)32-28(3,4)5/h26H,6-25H2,1-5H3 |
| InChIKey | MPIAKUVFJKWKJV-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|