C30H58N2O4 — CID 129293457
tert-butyl 4-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 129293457) has the molecular formula C30H58N2O4 and a molecular weight of 510.80 g/mol. Its IUPAC name is tert-butyl 4-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 129293457 |
| Molecular Formula | C30H58N2O4 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.44 |
| IUPAC Name | tert-butyl 4-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | CCCCCCCCCN(CCCC(=O)OCCCCC)CCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C30H58N2O4/c1-6-8-10-11-12-13-14-21-31(22-16-17-28(33)35-26-15-9-7-2)23-18-27-19-24-32(25-20-27)29(34)36-30(3,4)5/h27H,6-26H2,1-5H3 |
| InChIKey | WNGBLPLGDHIKHZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|