C57H114N4O3 — CID 139547436
pentyl 4-[3-[1-[3-[2-[di(nonyl)amino]ethyl-nonylamino]propanoyl]piperidin-4-yl]propyl-octylamino]butanoate (PubChem CID 139547436) has the molecular formula C57H114N4O3 and a molecular weight of 903.56 g/mol. Its IUPAC name is pentyl 4-[3-[1-[3-[2-[di(nonyl)amino]ethyl-nonylamino]propanoyl]piperidin-4-yl]propyl-octylamino]butanoate.
| Compound Name | pentyl 4-[3-[1-[3-[2-[di(nonyl)amino]ethyl-nonylamino]propanoyl]piperidin-4-yl]propyl-octylamino]butanoate |
|---|---|
| PubChem CID | 139547436 |
| Molecular Formula | C57H114N4O3 |
| Molecular Weight | 903.56 g/mol |
| Exact Mass | 902.89 |
| IUPAC Name | pentyl 4-[3-[1-[3-[2-[di(nonyl)amino]ethyl-nonylamino]propanoyl]piperidin-4-yl]propyl-octylamino]butanoate |
| SMILES | CCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCCC)CCC(=O)N1CCC(CCCN(CCCCCCCC)CCCC(=O)OCCCCC)CC1 |
| InChI | InChI=1S/C57H114N4O3/c1-6-11-16-20-24-28-32-44-59(45-33-29-25-21-17-12-7-2)52-53-60(46-34-30-26-22-18-13-8-3)49-42-56(62)61-50-40-55(41-51-61)38-36-47-58(43-31-27-23-19-14-9-4)48-37-39-57(63)64-54-35-15-10-5/h55H,6-54H2,1-5H3 |
| InChIKey | NKTJWEOUAQFDDA-UHFFFAOYSA-N |
| XLogP | 15.43 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.56 |
| LogP ≤ 5 | 15.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|