C29H56N2O4 — CID 135380236
tert-butyl (3S)-3-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 135380236) has the molecular formula C29H56N2O4 and a molecular weight of 496.78 g/mol. Its IUPAC name is tert-butyl (3S)-3-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135380236 |
| Molecular Formula | C29H56N2O4 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.42 |
| IUPAC Name | tert-butyl (3S)-3-[2-[nonyl-(4-oxo-4-pentoxybutyl)amino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCCN(CCCC(=O)OCCCCC)CC[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H56N2O4/c1-6-8-10-11-12-13-14-20-30(21-16-17-27(32)34-24-15-9-7-2)22-18-26-19-23-31(25-26)28(33)35-29(3,4)5/h26H,6-25H2,1-5H3/t26-/m0/s1 |
| InChIKey | WSUHBDJODJVHAT-SANMLTNESA-N |
| XLogP | 7.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|